About 4-(2-methoxyethenyl)-2,2-dimethyloxane
4-(2-methoxyethenyl)-2,2-dimethyloxane (PubChem CID 67314163) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is 4-(2-methoxyethenyl)-2,2-dimethyloxane.
Molecular Properties
| Compound Name | 4-(2-methoxyethenyl)-2,2-dimethyloxane |
| PubChem CID | 67314163 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 4-(2-methoxyethenyl)-2,2-dimethyloxane |
| SMILES | COC=CC1CCOC(C)(C)C1 |
| InChI | InChI=1S/C10H18O2/c1-10(2)8-9(4-6-11-3)5-7-12-10/h4,6,9H,5,7-8H2,1-3H3 |
| InChIKey | ZPLADRXUXCAQRM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methoxyethenyl)-2,2-dimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methoxyethenyl)-2,2-dimethyloxane?
The IUPAC name of 4-(2-methoxyethenyl)-2,2-dimethyloxane (CID 67314163) is 4-(2-methoxyethenyl)-2,2-dimethyloxane.
What is the SMILES notation for 4-(2-methoxyethenyl)-2,2-dimethyloxane?
The canonical SMILES for 4-(2-methoxyethenyl)-2,2-dimethyloxane is COC=CC1CCOC(C)(C)C1.
What is the InChIKey of 4-(2-methoxyethenyl)-2,2-dimethyloxane?
The InChIKey is ZPLADRXUXCAQRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-10(2)8-9(4-6-11-3)5-7-12-10/h4,6,9H,5,7-8H2,1-3H3.
What are the key properties of 4-(2-methoxyethenyl)-2,2-dimethyloxane?
4-(2-methoxyethenyl)-2,2-dimethyloxane has a molecular weight of 170.25 g/mol, XLogP of 2.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methoxyethenyl)-2,2-dimethyloxane is sourced from PubChem (CID 67314163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).