About (3R,4S)-4-methylpyrrolidin-3-ol;hydrochloride
(3R,4S)-4-methylpyrrolidin-3-ol;hydrochloride (PubChem CID 67314254) has the molecular formula C5H12ClNO
and a molecular weight of 137.61 g/mol. Its IUPAC name is (3R,4S)-4-methylpyrrolidin-3-ol;hydrochloride.
Molecular Properties
| Compound Name | (3R,4S)-4-methylpyrrolidin-3-ol;hydrochloride |
| PubChem CID | 67314254 |
| Molecular Formula | C5H12ClNO |
| Molecular Weight | 137.61 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | (3R,4S)-4-methylpyrrolidin-3-ol;hydrochloride |
| SMILES | C[C@H]1CNC[C@@H]1O.Cl |
| InChI | InChI=1S/C5H11NO.ClH/c1-4-2-6-3-5(4)7;/h4-7H,2-3H2,1H3;1H/t4-,5-;/m0./s1 |
| InChIKey | VBEGDUJNLVSIES-FHAQVOQBSA-N |
| XLogP | 0.01 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.61 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R,4S)-4-methylpyrrolidin-3-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-4-methylpyrrolidin-3-ol;hydrochloride?
The IUPAC name of (3R,4S)-4-methylpyrrolidin-3-ol;hydrochloride (CID 67314254) is (3R,4S)-4-methylpyrrolidin-3-ol;hydrochloride.
What is the SMILES notation for (3R,4S)-4-methylpyrrolidin-3-ol;hydrochloride?
The canonical SMILES for (3R,4S)-4-methylpyrrolidin-3-ol;hydrochloride is C[C@H]1CNC[C@@H]1O.Cl.
What is the InChIKey of (3R,4S)-4-methylpyrrolidin-3-ol;hydrochloride?
The InChIKey is VBEGDUJNLVSIES-FHAQVOQBSA-N. The full InChI is InChI=1S/C5H11NO.ClH/c1-4-2-6-3-5(4)7;/h4-7H,2-3H2,1H3;1H/t4-,5-;/m0./s1.
What are the key properties of (3R,4S)-4-methylpyrrolidin-3-ol;hydrochloride?
(3R,4S)-4-methylpyrrolidin-3-ol;hydrochloride has a molecular weight of 137.61 g/mol, XLogP of 0.01, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-4-methylpyrrolidin-3-ol;hydrochloride is sourced from PubChem (CID 67314254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).