About 20-hydroxy-3,18-dimethylcycloicos-10-en-1-one
20-hydroxy-3,18-dimethylcycloicos-10-en-1-one (PubChem CID 67314307) has the molecular formula C22H40O2
and a molecular weight of 336.56 g/mol. Its IUPAC name is 20-hydroxy-3,18-dimethylcycloicos-10-en-1-one.
Molecular Properties
| Compound Name | 20-hydroxy-3,18-dimethylcycloicos-10-en-1-one |
| PubChem CID | 67314307 |
| Molecular Formula | C22H40O2 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.30 |
| IUPAC Name | 20-hydroxy-3,18-dimethylcycloicos-10-en-1-one |
| SMILES | CC1CCCCCCC=CCCCCCCC(C)CC(O)C(=O)C1 |
| InChI | InChI=1S/C22H40O2/c1-19-15-13-11-9-7-5-3-4-6-8-10-12-14-16-20(2)18-22(24)21(23)17-19/h3-4,19-21,23H,5-18H2,1-2H3 |
| InChIKey | LOZQEXNZEZELAZ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 20-hydroxy-3,18-dimethylcycloicos-10-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 20-hydroxy-3,18-dimethylcycloicos-10-en-1-one?
The IUPAC name of 20-hydroxy-3,18-dimethylcycloicos-10-en-1-one (CID 67314307) is 20-hydroxy-3,18-dimethylcycloicos-10-en-1-one.
What is the SMILES notation for 20-hydroxy-3,18-dimethylcycloicos-10-en-1-one?
The canonical SMILES for 20-hydroxy-3,18-dimethylcycloicos-10-en-1-one is CC1CCCCCCC=CCCCCCCC(C)CC(O)C(=O)C1.
What is the InChIKey of 20-hydroxy-3,18-dimethylcycloicos-10-en-1-one?
The InChIKey is LOZQEXNZEZELAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H40O2/c1-19-15-13-11-9-7-5-3-4-6-8-10-12-14-16-20(2)18-22(24)21(23)17-19/h3-4,19-21,23H,5-18H2,1-2H3.
What are the key properties of 20-hydroxy-3,18-dimethylcycloicos-10-en-1-one?
20-hydroxy-3,18-dimethylcycloicos-10-en-1-one has a molecular weight of 336.56 g/mol, XLogP of 6.22, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 20-hydroxy-3,18-dimethylcycloicos-10-en-1-one is sourced from PubChem (CID 67314307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).