C21H22ClFN4O2 — CID 67314854
3-[7-chloro-6-[2-(diethylamino)ethylamino]-1H-furo[3,4-c]pyridin-3-ylidene]-5-fluoro-1H-indol-2-one (PubChem CID 67314854) has the molecular formula C21H22ClFN4O2 and a molecular weight of 416.88 g/mol. Its IUPAC name is 3-[7-chloro-6-[2-(diethylamino)ethylamino]-1H-furo[3,4-c]pyridin-3-ylidene]-5-fluoro-1H-indol-2-one.
| Compound Name | 3-[7-chloro-6-[2-(diethylamino)ethylamino]-1H-furo[3,4-c]pyridin-3-ylidene]-5-fluoro-1H-indol-2-one |
|---|---|
| PubChem CID | 67314854 |
| Molecular Formula | C21H22ClFN4O2 |
| Molecular Weight | 416.88 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 3-[7-chloro-6-[2-(diethylamino)ethylamino]-1H-furo[3,4-c]pyridin-3-ylidene]-5-fluoro-1H-indol-2-one |
| SMILES | CCN(CC)CCNc1ncc2c(c1Cl)COC2=C1C(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C21H22ClFN4O2/c1-3-27(4-2)8-7-24-20-18(22)15-11-29-19(14(15)10-25-20)17-13-9-12(23)5-6-16(13)26-21(17)28/h5-6,9-10H,3-4,7-8,11H2,1-2H3,(H,24,25)(H,26,28) |
| InChIKey | NHUHHARNUOWGQV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.88 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|