About 3-(5,5-dimethoxycyclohexa-1,3-dien-1-yl)propan-1-amine
3-(5,5-dimethoxycyclohexa-1,3-dien-1-yl)propan-1-amine (PubChem CID 67315390) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is 3-(5,5-dimethoxycyclohexa-1,3-dien-1-yl)propan-1-amine.
Molecular Properties
| Compound Name | 3-(5,5-dimethoxycyclohexa-1,3-dien-1-yl)propan-1-amine |
| PubChem CID | 67315390 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 3-(5,5-dimethoxycyclohexa-1,3-dien-1-yl)propan-1-amine |
| SMILES | COC1(OC)C=CC=C(CCCN)C1 |
| InChI | InChI=1S/C11H19NO2/c1-13-11(14-2)7-3-5-10(9-11)6-4-8-12/h3,5,7H,4,6,8-9,12H2,1-2H3 |
| InChIKey | GEKKLOKEBODUPO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(5,5-dimethoxycyclohexa-1,3-dien-1-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5,5-dimethoxycyclohexa-1,3-dien-1-yl)propan-1-amine?
The IUPAC name of 3-(5,5-dimethoxycyclohexa-1,3-dien-1-yl)propan-1-amine (CID 67315390) is 3-(5,5-dimethoxycyclohexa-1,3-dien-1-yl)propan-1-amine.
What is the SMILES notation for 3-(5,5-dimethoxycyclohexa-1,3-dien-1-yl)propan-1-amine?
The canonical SMILES for 3-(5,5-dimethoxycyclohexa-1,3-dien-1-yl)propan-1-amine is COC1(OC)C=CC=C(CCCN)C1.
What is the InChIKey of 3-(5,5-dimethoxycyclohexa-1,3-dien-1-yl)propan-1-amine?
The InChIKey is GEKKLOKEBODUPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-13-11(14-2)7-3-5-10(9-11)6-4-8-12/h3,5,7H,4,6,8-9,12H2,1-2H3.
What are the key properties of 3-(5,5-dimethoxycyclohexa-1,3-dien-1-yl)propan-1-amine?
3-(5,5-dimethoxycyclohexa-1,3-dien-1-yl)propan-1-amine has a molecular weight of 197.28 g/mol, XLogP of 1.60, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5,5-dimethoxycyclohexa-1,3-dien-1-yl)propan-1-amine is sourced from PubChem (CID 67315390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).