About 3-(2,4-dimethoxyphenyl)-5-(tetrazol-1-yl)benzoic acid
3-(2,4-dimethoxyphenyl)-5-(tetrazol-1-yl)benzoic acid (PubChem CID 67316318) has the molecular formula C16H14N4O4
and a molecular weight of 326.31 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-5-(tetrazol-1-yl)benzoic acid.
Molecular Properties
| Compound Name | 3-(2,4-dimethoxyphenyl)-5-(tetrazol-1-yl)benzoic acid |
| PubChem CID | 67316318 |
| Molecular Formula | C16H14N4O4 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-5-(tetrazol-1-yl)benzoic acid |
| SMILES | COc1ccc(-c2cc(C(=O)O)cc(-n3cnnn3)c2)c(OC)c1 |
| InChI | InChI=1S/C16H14N4O4/c1-23-13-3-4-14(15(8-13)24-2)10-5-11(16(21)22)7-12(6-10)20-9-17-18-19-20/h3-9H,1-2H3,(H,21,22) |
| InChIKey | OTXDOWIBHFYGBD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(2,4-dimethoxyphenyl)-5-(tetrazol-1-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dimethoxyphenyl)-5-(tetrazol-1-yl)benzoic acid?
The IUPAC name of 3-(2,4-dimethoxyphenyl)-5-(tetrazol-1-yl)benzoic acid (CID 67316318) is 3-(2,4-dimethoxyphenyl)-5-(tetrazol-1-yl)benzoic acid.
What is the SMILES notation for 3-(2,4-dimethoxyphenyl)-5-(tetrazol-1-yl)benzoic acid?
The canonical SMILES for 3-(2,4-dimethoxyphenyl)-5-(tetrazol-1-yl)benzoic acid is COc1ccc(-c2cc(C(=O)O)cc(-n3cnnn3)c2)c(OC)c1.
What is the InChIKey of 3-(2,4-dimethoxyphenyl)-5-(tetrazol-1-yl)benzoic acid?
The InChIKey is OTXDOWIBHFYGBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4O4/c1-23-13-3-4-14(15(8-13)24-2)10-5-11(16(21)22)7-12(6-10)20-9-17-18-19-20/h3-9H,1-2H3,(H,21,22).
What are the key properties of 3-(2,4-dimethoxyphenyl)-5-(tetrazol-1-yl)benzoic acid?
3-(2,4-dimethoxyphenyl)-5-(tetrazol-1-yl)benzoic acid has a molecular weight of 326.31 g/mol, XLogP of 2.04, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethoxyphenyl)-5-(tetrazol-1-yl)benzoic acid is sourced from PubChem (CID 67316318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).