C31H33NO4 — CID 67316979
5-hydroxy-3-(2-propan-2-ylphenyl)-1-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propyl]indole-2-carboxylic acid (PubChem CID 67316979) has the molecular formula C31H33NO4 and a molecular weight of 483.61 g/mol. Its IUPAC name is 5-hydroxy-3-(2-propan-2-ylphenyl)-1-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propyl]indole-2-carboxylic acid.
| Compound Name | 5-hydroxy-3-(2-propan-2-ylphenyl)-1-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 67316979 |
| Molecular Formula | C31H33NO4 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 5-hydroxy-3-(2-propan-2-ylphenyl)-1-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propyl]indole-2-carboxylic acid |
| SMILES | CC(C)c1ccccc1-c1c(C(=O)O)n(CCCOc2cccc3c2CCCC3)c2ccc(O)cc12 |
| InChI | InChI=1S/C31H33NO4/c1-20(2)23-11-5-6-13-25(23)29-26-19-22(33)15-16-27(26)32(30(29)31(34)35)17-8-18-36-28-14-7-10-21-9-3-4-12-24(21)28/h5-7,10-11,13-16,19-20,33H,3-4,8-9,12,17-18H2,1-2H3,(H,34,35) |
| InChIKey | FNSOHASLVYJWEB-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|