C26H27NO6 — CID 67317434
[(1S,2S)-2-[[3-[3-(1,3-dioxoisoindol-2-yl)propanoyl]phenoxy]methyl]cyclohexyl] acetate (PubChem CID 67317434) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is [(1S,2S)-2-[[3-[3-(1,3-dioxoisoindol-2-yl)propanoyl]phenoxy]methyl]cyclohexyl] acetate.
| Compound Name | [(1S,2S)-2-[[3-[3-(1,3-dioxoisoindol-2-yl)propanoyl]phenoxy]methyl]cyclohexyl] acetate |
|---|---|
| PubChem CID | 67317434 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | [(1S,2S)-2-[[3-[3-(1,3-dioxoisoindol-2-yl)propanoyl]phenoxy]methyl]cyclohexyl] acetate |
| SMILES | CC(=O)O[C@H]1CCCC[C@H]1COc1cccc(C(=O)CCN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C26H27NO6/c1-17(28)33-24-12-5-2-7-19(24)16-32-20-9-6-8-18(15-20)23(29)13-14-27-25(30)21-10-3-4-11-22(21)26(27)31/h3-4,6,8-11,15,19,24H,2,5,7,12-14,16H2,1H3/t19-,24-/m0/s1 |
| InChIKey | YYQYLGOWSJFRBL-CYFREDJKSA-N |
| XLogP | 4.06 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|