(1R,4S)-4-(methylamino)cyclopent-2-ene-1-carboxylic acid

C7H11NO2 — CID 67317476

IUPAC(1R,4S)-4-(methylamino)cyclopent-2-ene-1-carboxylic acid
SMILESCN[C@@H]1C=C[C@H](C(=O)O)C1
InChIInChI=1S/C7H11NO2/c1-8-6-3-2-5(4-6)7(9)10/h2-3,5-6,8H,4H2,1H3,(H,9,10)/t5-,6+/m0/s1
InChIKeyKAPYCHNQJJRQIG-NTSWFWBYSA-N
MW141.17 g/mol
LogP0.24
Rot. Bonds2

About (1R,4S)-4-(methylamino)cyclopent-2-ene-1-carboxylic acid

(1R,4S)-4-(methylamino)cyclopent-2-ene-1-carboxylic acid (PubChem CID 67317476) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is (1R,4S)-4-(methylamino)cyclopent-2-ene-1-carboxylic acid.

Molecular Properties

Compound Name(1R,4S)-4-(methylamino)cyclopent-2-ene-1-carboxylic acid
PubChem CID67317476
Molecular FormulaC7H11NO2
Molecular Weight141.17 g/mol
Exact Mass141.08
IUPAC Name(1R,4S)-4-(methylamino)cyclopent-2-ene-1-carboxylic acid
SMILESCN[C@@H]1C=C[C@H](C(=O)O)C1
InChIInChI=1S/C7H11NO2/c1-8-6-3-2-5(4-6)7(9)10/h2-3,5-6,8H,4H2,1H3,(H,9,10)/t5-,6+/m0/s1
InChIKeyKAPYCHNQJJRQIG-NTSWFWBYSA-N
XLogP0.24
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500141.17
LogP ≤ 50.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (1R,4S)-4-(methylamino)cyclopent-2-ene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1R,4S)-4-(methylamino)cyclopent-2-ene-1-carboxylic acid?
The IUPAC name of (1R,4S)-4-(methylamino)cyclopent-2-ene-1-carboxylic acid (CID 67317476) is (1R,4S)-4-(methylamino)cyclopent-2-ene-1-carboxylic acid.
What is the SMILES notation for (1R,4S)-4-(methylamino)cyclopent-2-ene-1-carboxylic acid?
The canonical SMILES for (1R,4S)-4-(methylamino)cyclopent-2-ene-1-carboxylic acid is CN[C@@H]1C=C[C@H](C(=O)O)C1.
What is the InChIKey of (1R,4S)-4-(methylamino)cyclopent-2-ene-1-carboxylic acid?
The InChIKey is KAPYCHNQJJRQIG-NTSWFWBYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-8-6-3-2-5(4-6)7(9)10/h2-3,5-6,8H,4H2,1H3,(H,9,10)/t5-,6+/m0/s1.
What are the key properties of (1R,4S)-4-(methylamino)cyclopent-2-ene-1-carboxylic acid?
(1R,4S)-4-(methylamino)cyclopent-2-ene-1-carboxylic acid has a molecular weight of 141.17 g/mol, XLogP of 0.24, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,4S)-4-(methylamino)cyclopent-2-ene-1-carboxylic acid is sourced from PubChem (CID 67317476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).