C30H37N3O5S — CID 67318601
1-[cycloheptyl(prop-2-enoyl)amino]propan-2-yl-[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)-3-phenylpropyl]carbamic acid (PubChem CID 67318601) has the molecular formula C30H37N3O5S and a molecular weight of 551.71 g/mol. Its IUPAC name is 1-[cycloheptyl(prop-2-enoyl)amino]propan-2-yl-[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)-3-phenylpropyl]carbamic acid.
| Compound Name | 1-[cycloheptyl(prop-2-enoyl)amino]propan-2-yl-[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)-3-phenylpropyl]carbamic acid |
|---|---|
| PubChem CID | 67318601 |
| Molecular Formula | C30H37N3O5S |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | 1-[cycloheptyl(prop-2-enoyl)amino]propan-2-yl-[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)-3-phenylpropyl]carbamic acid |
| SMILES | C=CC(=O)N(CC(C)N(CC(Cc1ccccc1)c1ccc(O)c2[nH]c(=O)sc12)C(=O)O)C1CCCCCC1 |
| InChI | InChI=1S/C30H37N3O5S/c1-3-26(35)33(23-13-9-4-5-10-14-23)18-20(2)32(30(37)38)19-22(17-21-11-7-6-8-12-21)24-15-16-25(34)27-28(24)39-29(36)31-27/h3,6-8,11-12,15-16,20,22-23,34H,1,4-5,9-10,13-14,17-19H2,2H3,(H,31,36)(H,37,38) |
| InChIKey | ONZXMIDOXSGFRL-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|