C24H22N6O5 — CID 67318619
(6'aS,7'S,9'R)-7',9'-dimethyl-3'-(5-phenyl-1,2,4-oxadiazol-3-yl)spiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,8]naphthyridine]-2,4,6-trione (PubChem CID 67318619) has the molecular formula C24H22N6O5 and a molecular weight of 474.48 g/mol. Its IUPAC name is (6'aS,7'S,9'R)-7',9'-dimethyl-3'-(5-phenyl-1,2,4-oxadiazol-3-yl)spiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,8]naphthyridine]-2,4,6-trione.
| Compound Name | (6'aS,7'S,9'R)-7',9'-dimethyl-3'-(5-phenyl-1,2,4-oxadiazol-3-yl)spiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,8]naphthyridine]-2,4,6-trione |
|---|---|
| PubChem CID | 67318619 |
| Molecular Formula | C24H22N6O5 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | (6'aS,7'S,9'R)-7',9'-dimethyl-3'-(5-phenyl-1,2,4-oxadiazol-3-yl)spiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,8]naphthyridine]-2,4,6-trione |
| SMILES | C[C@@H]1CN2c3ncc(-c4noc(-c5ccccc5)n4)cc3CC3(C(=O)NC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C24H22N6O5/c1-12-11-30-17(13(2)34-12)24(21(31)27-23(33)28-22(24)32)9-15-8-16(10-25-19(15)30)18-26-20(35-29-18)14-6-4-3-5-7-14/h3-8,10,12-13,17H,9,11H2,1-2H3,(H2,27,28,31,32,33)/t12-,13+,17-/m1/s1 |
| InChIKey | YDFVSYFEHPTDJV-IIYDPXPESA-N |
| XLogP | 1.69 |
| TPSA | 139.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|