C24H29F2NO4S — CID 67318774
7-[(2R)-2-[(3R)-4-(1-benzothiophen-2-yl)-4,4-difluoro-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]heptanoic acid (PubChem CID 67318774) has the molecular formula C24H29F2NO4S and a molecular weight of 465.56 g/mol. Its IUPAC name is 7-[(2R)-2-[(3R)-4-(1-benzothiophen-2-yl)-4,4-difluoro-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]heptanoic acid.
| Compound Name | 7-[(2R)-2-[(3R)-4-(1-benzothiophen-2-yl)-4,4-difluoro-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 67318774 |
| Molecular Formula | C24H29F2NO4S |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 7-[(2R)-2-[(3R)-4-(1-benzothiophen-2-yl)-4,4-difluoro-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCN1C(=O)CCC[C@@H]1C=C[C@@H](O)C(F)(F)c1cc2ccccc2s1 |
| InChI | InChI=1S/C24H29F2NO4S/c25-24(26,21-16-17-8-4-5-10-19(17)32-21)20(28)14-13-18-9-7-11-22(29)27(18)15-6-2-1-3-12-23(30)31/h4-5,8,10,13-14,16,18,20,28H,1-3,6-7,9,11-12,15H2,(H,30,31)/t18-,20-/m1/s1 |
| InChIKey | PTOSDIVFVLCYIY-UYAOXDASSA-N |
| XLogP | 5.33 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|