C21H20ClN5O4 — CID 67318965
(6'aS,7'S,9'R)-3'-(5-chloro-2-pyridinyl)-7',9'-dimethylspiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,8]naphthyridine]-2,4,6-trione (PubChem CID 67318965) has the molecular formula C21H20ClN5O4 and a molecular weight of 441.88 g/mol. Its IUPAC name is (6'aS,7'S,9'R)-3'-(5-chloro-2-pyridinyl)-7',9'-dimethylspiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,8]naphthyridine]-2,4,6-trione.
| Compound Name | (6'aS,7'S,9'R)-3'-(5-chloro-2-pyridinyl)-7',9'-dimethylspiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,8]naphthyridine]-2,4,6-trione |
|---|---|
| PubChem CID | 67318965 |
| Molecular Formula | C21H20ClN5O4 |
| Molecular Weight | 441.88 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | (6'aS,7'S,9'R)-3'-(5-chloro-2-pyridinyl)-7',9'-dimethylspiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,8]naphthyridine]-2,4,6-trione |
| SMILES | C[C@@H]1CN2c3ncc(-c4ccc(Cl)cn4)cc3CC3(C(=O)NC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C21H20ClN5O4/c1-10-9-27-16(11(2)31-10)21(18(28)25-20(30)26-19(21)29)6-12-5-13(7-24-17(12)27)15-4-3-14(22)8-23-15/h3-5,7-8,10-11,16H,6,9H2,1-2H3,(H2,25,26,28,29,30)/t10-,11+,16-/m1/s1 |
| InChIKey | QNHXSQYPHTVPQR-OHUAYANFSA-N |
| XLogP | 1.69 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.88 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|