C22H25N7O4 — CID 67318983
(6'aS,7'S,9'R)-3'-[2-(dimethylamino)pyrimidin-5-yl]-7',9'-dimethylspiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,8]naphthyridine]-2,4,6-trione (PubChem CID 67318983) has the molecular formula C22H25N7O4 and a molecular weight of 451.49 g/mol. Its IUPAC name is (6'aS,7'S,9'R)-3'-[2-(dimethylamino)pyrimidin-5-yl]-7',9'-dimethylspiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,8]naphthyridine]-2,4,6-trione.
| Compound Name | (6'aS,7'S,9'R)-3'-[2-(dimethylamino)pyrimidin-5-yl]-7',9'-dimethylspiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,8]naphthyridine]-2,4,6-trione |
|---|---|
| PubChem CID | 67318983 |
| Molecular Formula | C22H25N7O4 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | (6'aS,7'S,9'R)-3'-[2-(dimethylamino)pyrimidin-5-yl]-7',9'-dimethylspiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,8]naphthyridine]-2,4,6-trione |
| SMILES | C[C@@H]1CN2c3ncc(-c4cnc(N(C)C)nc4)cc3CC3(C(=O)NC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C22H25N7O4/c1-11-10-29-16(12(2)33-11)22(18(30)26-21(32)27-19(22)31)6-13-5-14(7-23-17(13)29)15-8-24-20(25-9-15)28(3)4/h5,7-9,11-12,16H,6,10H2,1-4H3,(H2,26,27,30,31,32)/t11-,12+,16-/m1/s1 |
| InChIKey | LNGKWOPTHTTZMD-BFQNTYOBSA-N |
| XLogP | 0.50 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|