C16H17FN4O4 — CID 67319061
(6'aS,7'S,9'R)-2'-fluoro-7',9'-dimethylspiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,8]naphthyridine]-2,4,6-trione (PubChem CID 67319061) has the molecular formula C16H17FN4O4 and a molecular weight of 348.33 g/mol. Its IUPAC name is (6'aS,7'S,9'R)-2'-fluoro-7',9'-dimethylspiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,8]naphthyridine]-2,4,6-trione.
| Compound Name | (6'aS,7'S,9'R)-2'-fluoro-7',9'-dimethylspiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,8]naphthyridine]-2,4,6-trione |
|---|---|
| PubChem CID | 67319061 |
| Molecular Formula | C16H17FN4O4 |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | (6'aS,7'S,9'R)-2'-fluoro-7',9'-dimethylspiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,8]naphthyridine]-2,4,6-trione |
| SMILES | C[C@@H]1CN2c3nc(F)ccc3CC3(C(=O)NC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C16H17FN4O4/c1-7-6-21-11(8(2)25-7)16(13(22)19-15(24)20-14(16)23)5-9-3-4-10(17)18-12(9)21/h3-4,7-8,11H,5-6H2,1-2H3,(H2,19,20,22,23,24)/t7-,8+,11-/m1/s1 |
| InChIKey | MFRRNRYDJKNXSW-VHSKPIJISA-N |
| XLogP | 0.11 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|