About 2-ethenyl-4-propoxyoxane
2-ethenyl-4-propoxyoxane (PubChem CID 67319194) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is 2-ethenyl-4-propoxyoxane.
Molecular Properties
| Compound Name | 2-ethenyl-4-propoxyoxane |
| PubChem CID | 67319194 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 2-ethenyl-4-propoxyoxane |
| SMILES | C=CC1CC(OCCC)CCO1 |
| InChI | InChI=1S/C10H18O2/c1-3-6-11-10-5-7-12-9(4-2)8-10/h4,9-10H,2-3,5-8H2,1H3 |
| InChIKey | IYGDLZQFJVMTBK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-4-propoxyoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-4-propoxyoxane?
The IUPAC name of 2-ethenyl-4-propoxyoxane (CID 67319194) is 2-ethenyl-4-propoxyoxane.
What is the SMILES notation for 2-ethenyl-4-propoxyoxane?
The canonical SMILES for 2-ethenyl-4-propoxyoxane is C=CC1CC(OCCC)CCO1.
What is the InChIKey of 2-ethenyl-4-propoxyoxane?
The InChIKey is IYGDLZQFJVMTBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-3-6-11-10-5-7-12-9(4-2)8-10/h4,9-10H,2-3,5-8H2,1H3.
What are the key properties of 2-ethenyl-4-propoxyoxane?
2-ethenyl-4-propoxyoxane has a molecular weight of 170.25 g/mol, XLogP of 2.15, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-4-propoxyoxane is sourced from PubChem (CID 67319194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).