C23H24N4O4 — CID 67319339
(6'aS,7'S,9'R)-7',9'-dimethyl-3'-(2-methylphenyl)spiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,8]naphthyridine]-2,4,6-trione (PubChem CID 67319339) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is (6'aS,7'S,9'R)-7',9'-dimethyl-3'-(2-methylphenyl)spiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,8]naphthyridine]-2,4,6-trione.
| Compound Name | (6'aS,7'S,9'R)-7',9'-dimethyl-3'-(2-methylphenyl)spiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,8]naphthyridine]-2,4,6-trione |
|---|---|
| PubChem CID | 67319339 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | (6'aS,7'S,9'R)-7',9'-dimethyl-3'-(2-methylphenyl)spiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,8]naphthyridine]-2,4,6-trione |
| SMILES | Cc1ccccc1-c1cnc2c(c1)CC1(C(=O)NC(=O)NC1=O)[C@H]1[C@H](C)O[C@H](C)CN21 |
| InChI | InChI=1S/C23H24N4O4/c1-12-6-4-5-7-17(12)16-8-15-9-23(20(28)25-22(30)26-21(23)29)18-14(3)31-13(2)11-27(18)19(15)24-10-16/h4-8,10,13-14,18H,9,11H2,1-3H3,(H2,25,26,28,29,30)/t13-,14+,18-/m1/s1 |
| InChIKey | ROYCSDLLTMRLAH-QWQRMKEZSA-N |
| XLogP | 1.95 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|