4-methoxy-1,2-dimethyl-5-phenylpyrrole-3-carboxylic acid

C14H15NO3 — CID 67319956

IUPAC4-methoxy-1,2-dimethyl-5-phenylpyrrole-3-carboxylic acid
SMILESCOc1c(C(=O)O)c(C)n(C)c1-c1ccccc1
InChIInChI=1S/C14H15NO3/c1-9-11(14(16)17)13(18-3)12(15(9)2)10-7-5-4-6-8-10/h4-8H,1-3H3,(H,16,17)
InChIKeyUPHBBWVOERVUOT-UHFFFAOYSA-N
MW245.28 g/mol
LogP2.71
Rot. Bonds3

About 4-methoxy-1,2-dimethyl-5-phenylpyrrole-3-carboxylic acid

4-methoxy-1,2-dimethyl-5-phenylpyrrole-3-carboxylic acid (PubChem CID 67319956) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 4-methoxy-1,2-dimethyl-5-phenylpyrrole-3-carboxylic acid.

Molecular Properties

Compound Name4-methoxy-1,2-dimethyl-5-phenylpyrrole-3-carboxylic acid
PubChem CID67319956
Molecular FormulaC14H15NO3
Molecular Weight245.28 g/mol
Exact Mass245.11
IUPAC Name4-methoxy-1,2-dimethyl-5-phenylpyrrole-3-carboxylic acid
SMILESCOc1c(C(=O)O)c(C)n(C)c1-c1ccccc1
InChIInChI=1S/C14H15NO3/c1-9-11(14(16)17)13(18-3)12(15(9)2)10-7-5-4-6-8-10/h4-8H,1-3H3,(H,16,17)
InChIKeyUPHBBWVOERVUOT-UHFFFAOYSA-N
XLogP2.71
TPSA51.46 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.28
LogP ≤ 52.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-methoxy-1,2-dimethyl-5-phenylpyrrole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methoxy-1,2-dimethyl-5-phenylpyrrole-3-carboxylic acid?
The IUPAC name of 4-methoxy-1,2-dimethyl-5-phenylpyrrole-3-carboxylic acid (CID 67319956) is 4-methoxy-1,2-dimethyl-5-phenylpyrrole-3-carboxylic acid.
What is the SMILES notation for 4-methoxy-1,2-dimethyl-5-phenylpyrrole-3-carboxylic acid?
The canonical SMILES for 4-methoxy-1,2-dimethyl-5-phenylpyrrole-3-carboxylic acid is COc1c(C(=O)O)c(C)n(C)c1-c1ccccc1.
What is the InChIKey of 4-methoxy-1,2-dimethyl-5-phenylpyrrole-3-carboxylic acid?
The InChIKey is UPHBBWVOERVUOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO3/c1-9-11(14(16)17)13(18-3)12(15(9)2)10-7-5-4-6-8-10/h4-8H,1-3H3,(H,16,17).
What are the key properties of 4-methoxy-1,2-dimethyl-5-phenylpyrrole-3-carboxylic acid?
4-methoxy-1,2-dimethyl-5-phenylpyrrole-3-carboxylic acid has a molecular weight of 245.28 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1,2-dimethyl-5-phenylpyrrole-3-carboxylic acid is sourced from PubChem (CID 67319956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).