C22H23N5O5 — CID 67319969
(2'R,4'S,4'aS)-8'-(4-methoxy-3-pyridinyl)-2',4'-dimethylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridine]-2,4,6-trione (PubChem CID 67319969) has the molecular formula C22H23N5O5 and a molecular weight of 437.46 g/mol. Its IUPAC name is (2'R,4'S,4'aS)-8'-(4-methoxy-3-pyridinyl)-2',4'-dimethylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridine]-2,4,6-trione.
| Compound Name | (2'R,4'S,4'aS)-8'-(4-methoxy-3-pyridinyl)-2',4'-dimethylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridine]-2,4,6-trione |
|---|---|
| PubChem CID | 67319969 |
| Molecular Formula | C22H23N5O5 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | (2'R,4'S,4'aS)-8'-(4-methoxy-3-pyridinyl)-2',4'-dimethylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridine]-2,4,6-trione |
| SMILES | COc1ccncc1-c1ccc2c(n1)CC1(C(=O)NC(=O)NC1=O)[C@H]1[C@H](C)O[C@H](C)CN21 |
| InChI | InChI=1S/C22H23N5O5/c1-11-10-27-16-5-4-14(13-9-23-7-6-17(13)31-3)24-15(16)8-22(18(27)12(2)32-11)19(28)25-21(30)26-20(22)29/h4-7,9,11-12,18H,8,10H2,1-3H3,(H2,25,26,28,29,30)/t11-,12+,18-/m1/s1 |
| InChIKey | LVPSXXGCALPPGP-FTLABTOESA-N |
| XLogP | 1.04 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|