C31H22N6O2 — CID 67320165
2-amino-N-[4-[(5-dibenzofuran-4-ylpyrazolo[1,5-c]pyrimidin-7-yl)amino]phenyl]benzamide (PubChem CID 67320165) has the molecular formula C31H22N6O2 and a molecular weight of 510.56 g/mol. Its IUPAC name is 2-amino-N-[4-[(5-dibenzofuran-4-ylpyrazolo[1,5-c]pyrimidin-7-yl)amino]phenyl]benzamide.
| Compound Name | 2-amino-N-[4-[(5-dibenzofuran-4-ylpyrazolo[1,5-c]pyrimidin-7-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 67320165 |
| Molecular Formula | C31H22N6O2 |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 2-amino-N-[4-[(5-dibenzofuran-4-ylpyrazolo[1,5-c]pyrimidin-7-yl)amino]phenyl]benzamide |
| SMILES | Nc1ccccc1C(=O)Nc1ccc(Nc2nc(-c3cccc4c3oc3ccccc34)cc3ccnn23)cc1 |
| InChI | InChI=1S/C31H22N6O2/c32-26-10-3-1-7-24(26)30(38)34-19-12-14-20(15-13-19)35-31-36-27(18-21-16-17-33-37(21)31)25-9-5-8-23-22-6-2-4-11-28(22)39-29(23)25/h1-18H,32H2,(H,34,38)(H,35,36) |
| InChIKey | YNTWFAQPOGHKJM-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 110.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|