C18H25N3O5 — CID 67320337
[(8S,11R)-3,10-dioxo-8-propan-2-yl-6-oxa-2,9-diazabicyclo[11.2.2]heptadeca-1(15),13,16-trien-11-yl]carbamic acid (PubChem CID 67320337) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is [(8S,11R)-3,10-dioxo-8-propan-2-yl-6-oxa-2,9-diazabicyclo[11.2.2]heptadeca-1(15),13,16-trien-11-yl]carbamic acid.
| Compound Name | [(8S,11R)-3,10-dioxo-8-propan-2-yl-6-oxa-2,9-diazabicyclo[11.2.2]heptadeca-1(15),13,16-trien-11-yl]carbamic acid |
|---|---|
| PubChem CID | 67320337 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | [(8S,11R)-3,10-dioxo-8-propan-2-yl-6-oxa-2,9-diazabicyclo[11.2.2]heptadeca-1(15),13,16-trien-11-yl]carbamic acid |
| SMILES | CC(C)[C@H]1COCCC(=O)Nc2ccc(cc2)C[C@@H](NC(=O)O)C(=O)N1 |
| InChI | InChI=1S/C18H25N3O5/c1-11(2)15-10-26-8-7-16(22)19-13-5-3-12(4-6-13)9-14(17(23)20-15)21-18(24)25/h3-6,11,14-15,21H,7-10H2,1-2H3,(H,19,22)(H,20,23)(H,24,25)/t14-,15-/m1/s1 |
| InChIKey | QAAAPDUWMUDCBR-HUUCEWRRSA-N |
| XLogP | 1.36 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |