C32H33N7O3 — CID 67320348
tert-butyl 4-[4-[[(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)amino]methyl]benzoyl]piperazine-1-carboxylate (PubChem CID 67320348) has the molecular formula C32H33N7O3 and a molecular weight of 563.66 g/mol. Its IUPAC name is tert-butyl 4-[4-[[(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)amino]methyl]benzoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)amino]methyl]benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 67320348 |
| Molecular Formula | C32H33N7O3 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.26 |
| IUPAC Name | tert-butyl 4-[4-[[(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)amino]methyl]benzoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)c2ccc(CNc3cnc4[nH]c5cnc(-c6cccnc6)cc5c4c3)cc2)CC1 |
| InChI | InChI=1S/C32H33N7O3/c1-32(2,3)42-31(41)39-13-11-38(12-14-39)30(40)22-8-6-21(7-9-22)17-34-24-15-26-25-16-27(23-5-4-10-33-18-23)35-20-28(25)37-29(26)36-19-24/h4-10,15-16,18-20,34H,11-14,17H2,1-3H3,(H,36,37) |
| InChIKey | IKMVCEWUKBOMEW-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |