C9H7F2N3OS — CID 67320433
[2,6-difluoro-5-(5-methyl-1,3,4-thiadiazol-2-yl)-3-pyridinyl]methanol (PubChem CID 67320433) has the molecular formula C9H7F2N3OS and a molecular weight of 243.24 g/mol. Its IUPAC name is [2,6-difluoro-5-(5-methyl-1,3,4-thiadiazol-2-yl)-3-pyridinyl]methanol.
| Compound Name | [2,6-difluoro-5-(5-methyl-1,3,4-thiadiazol-2-yl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 67320433 |
| Molecular Formula | C9H7F2N3OS |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | [2,6-difluoro-5-(5-methyl-1,3,4-thiadiazol-2-yl)-3-pyridinyl]methanol |
| SMILES | Cc1nnc(-c2cc(CO)c(F)nc2F)s1 |
| InChI | InChI=1S/C9H7F2N3OS/c1-4-13-14-9(16-4)6-2-5(3-15)7(10)12-8(6)11/h2,15H,3H2,1H3 |
| InChIKey | STROSFCDMNBGFV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|