C19H34BN3O4 — CID 67320658
tert-butyl-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]pentyl]carbamic acid (PubChem CID 67320658) has the molecular formula C19H34BN3O4 and a molecular weight of 379.31 g/mol. Its IUPAC name is tert-butyl-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]pentyl]carbamic acid.
| Compound Name | tert-butyl-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]pentyl]carbamic acid |
|---|---|
| PubChem CID | 67320658 |
| Molecular Formula | C19H34BN3O4 |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | tert-butyl-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]pentyl]carbamic acid |
| SMILES | CC(C)(C)N(CCCCCn1cc(B2OC(C)(C)C(C)(C)O2)cn1)C(=O)O |
| InChI | InChI=1S/C19H34BN3O4/c1-17(2,3)23(16(24)25)12-10-8-9-11-22-14-15(13-21-22)20-26-18(4,5)19(6,7)27-20/h13-14H,8-12H2,1-7H3,(H,24,25) |
| InChIKey | LMLIMIQTXKYWOO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|