C27H36FN5O6 — CID 67320706
3-(6-amino-3-pyridinyl)-2-[[(9S,12R)-16-fluoro-11-oxo-9-propan-2-yl-2,7-dioxa-10-azabicyclo[12.2.2]octadeca-1(16),14,17-trien-12-yl]carbamoylamino]propanoic acid (PubChem CID 67320706) has the molecular formula C27H36FN5O6 and a molecular weight of 545.61 g/mol. Its IUPAC name is 3-(6-amino-3-pyridinyl)-2-[[(9S,12R)-16-fluoro-11-oxo-9-propan-2-yl-2,7-dioxa-10-azabicyclo[12.2.2]octadeca-1(16),14,17-trien-12-yl]carbamoylamino]propanoic acid.
| Compound Name | 3-(6-amino-3-pyridinyl)-2-[[(9S,12R)-16-fluoro-11-oxo-9-propan-2-yl-2,7-dioxa-10-azabicyclo[12.2.2]octadeca-1(16),14,17-trien-12-yl]carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 67320706 |
| Molecular Formula | C27H36FN5O6 |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | 3-(6-amino-3-pyridinyl)-2-[[(9S,12R)-16-fluoro-11-oxo-9-propan-2-yl-2,7-dioxa-10-azabicyclo[12.2.2]octadeca-1(16),14,17-trien-12-yl]carbamoylamino]propanoic acid |
| SMILES | CC(C)[C@H]1COCCCCOc2ccc(cc2F)C[C@@H](NC(=O)NC(Cc2ccc(N)nc2)C(=O)O)C(=O)N1 |
| InChI | InChI=1S/C27H36FN5O6/c1-16(2)22-15-38-9-3-4-10-39-23-7-5-17(11-19(23)28)12-20(25(34)31-22)32-27(37)33-21(26(35)36)13-18-6-8-24(29)30-14-18/h5-8,11,14,16,20-22H,3-4,9-10,12-13,15H2,1-2H3,(H2,29,30)(H,31,34)(H,35,36)(H2,32,33,37)/t20-,21?,22-/m1/s1 |
| InChIKey | PXDQHVXCCCTJKZ-NHXNGRAPSA-N |
| XLogP | 2.04 |
| TPSA | 164.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |