About (E)-3-(6-bromo-6-ethoxycyclohexa-2,4-dien-1-yl)prop-2-enoic acid
(E)-3-(6-bromo-6-ethoxycyclohexa-2,4-dien-1-yl)prop-2-enoic acid (PubChem CID 67321133) has the molecular formula C11H13BrO3
and a molecular weight of 273.13 g/mol. Its IUPAC name is (E)-3-(6-bromo-6-ethoxycyclohexa-2,4-dien-1-yl)prop-2-enoic acid.
Molecular Properties
| Compound Name | (E)-3-(6-bromo-6-ethoxycyclohexa-2,4-dien-1-yl)prop-2-enoic acid |
| PubChem CID | 67321133 |
| Molecular Formula | C11H13BrO3 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | (E)-3-(6-bromo-6-ethoxycyclohexa-2,4-dien-1-yl)prop-2-enoic acid |
| SMILES | CCOC1(Br)C=CC=CC1/C=C/C(=O)O |
| InChI | InChI=1S/C11H13BrO3/c1-2-15-11(12)8-4-3-5-9(11)6-7-10(13)14/h3-9H,2H2,1H3,(H,13,14)/b7-6+ |
| InChIKey | FTJBMJQFLPLAHG-VOTSOKGWSA-N |
| XLogP | 2.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(6-bromo-6-ethoxycyclohexa-2,4-dien-1-yl)prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(6-bromo-6-ethoxycyclohexa-2,4-dien-1-yl)prop-2-enoic acid?
The IUPAC name of (E)-3-(6-bromo-6-ethoxycyclohexa-2,4-dien-1-yl)prop-2-enoic acid (CID 67321133) is (E)-3-(6-bromo-6-ethoxycyclohexa-2,4-dien-1-yl)prop-2-enoic acid.
What is the SMILES notation for (E)-3-(6-bromo-6-ethoxycyclohexa-2,4-dien-1-yl)prop-2-enoic acid?
The canonical SMILES for (E)-3-(6-bromo-6-ethoxycyclohexa-2,4-dien-1-yl)prop-2-enoic acid is CCOC1(Br)C=CC=CC1/C=C/C(=O)O.
What is the InChIKey of (E)-3-(6-bromo-6-ethoxycyclohexa-2,4-dien-1-yl)prop-2-enoic acid?
The InChIKey is FTJBMJQFLPLAHG-VOTSOKGWSA-N. The full InChI is InChI=1S/C11H13BrO3/c1-2-15-11(12)8-4-3-5-9(11)6-7-10(13)14/h3-9H,2H2,1H3,(H,13,14)/b7-6+.
What are the key properties of (E)-3-(6-bromo-6-ethoxycyclohexa-2,4-dien-1-yl)prop-2-enoic acid?
(E)-3-(6-bromo-6-ethoxycyclohexa-2,4-dien-1-yl)prop-2-enoic acid has a molecular weight of 273.13 g/mol, XLogP of 2.50, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(6-bromo-6-ethoxycyclohexa-2,4-dien-1-yl)prop-2-enoic acid is sourced from PubChem (CID 67321133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).