C41H46FIN2O5 — CID 67321209
3-[5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]propyl-dimethyl-[(2-methyl-2-phenylpropanoyl)oxymethyl]azanium;(2,3-dimethylphenyl) acetate;iodide (PubChem CID 67321209) has the molecular formula C41H46FIN2O5 and a molecular weight of 792.73 g/mol. Its IUPAC name is 3-[5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]propyl-dimethyl-[(2-methyl-2-phenylpropanoyl)oxymethyl]azanium;(2,3-dimethylphenyl) acetate;iodide.
| Compound Name | 3-[5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]propyl-dimethyl-[(2-methyl-2-phenylpropanoyl)oxymethyl]azanium;(2,3-dimethylphenyl) acetate;iodide |
|---|---|
| PubChem CID | 67321209 |
| Molecular Formula | C41H46FIN2O5 |
| Molecular Weight | 792.73 g/mol |
| Exact Mass | 792.24 |
| IUPAC Name | 3-[5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]propyl-dimethyl-[(2-methyl-2-phenylpropanoyl)oxymethyl]azanium;(2,3-dimethylphenyl) acetate;iodide |
| SMILES | CC(=O)Oc1cccc(C)c1C.CC(C)(C(=O)OC[N+](C)(C)CCCC1(c2ccc(F)cc2)OCc2cc(C#N)ccc21)c1ccccc1.[I-] |
| InChI | InChI=1S/C31H34FN2O3.C10H12O2.HI/c1-30(2,25-9-6-5-7-10-25)29(35)36-22-34(3,4)18-8-17-31(26-12-14-27(32)15-13-26)28-16-11-23(20-33)19-24(28)21-37-31;1-7-5-4-6-10(8(7)2)12-9(3)11;/h5-7,9-16,19H,8,17-18,21-22H2,1-4H3;4-6H,1-3H3;1H/q+1;;/p-1 |
| InChIKey | JFCRHJVJAZPZQE-UHFFFAOYSA-M |
| XLogP | 5.04 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.73 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|