About [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]-ethylcarbamic acid
[3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]-ethylcarbamic acid (PubChem CID 67321519) has the molecular formula C20H17F2N3O3
and a molecular weight of 385.37 g/mol. Its IUPAC name is [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]-ethylcarbamic acid.
Molecular Properties
| Compound Name | [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]-ethylcarbamic acid |
| PubChem CID | 67321519 |
| Molecular Formula | C20H17F2N3O3 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]-ethylcarbamic acid |
| SMILES | CCN(C(=O)O)c1cccc(Cc2nn(-c3cc(F)cc(F)c3)ccc2=O)c1 |
| InChI | InChI=1S/C20H17F2N3O3/c1-2-24(20(27)28)16-5-3-4-13(8-16)9-18-19(26)6-7-25(23-18)17-11-14(21)10-15(22)12-17/h3-8,10-12H,2,9H2,1H3,(H,27,28) |
| InChIKey | XNPYPGUEKTZTCX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]-ethylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]-ethylcarbamic acid?
The IUPAC name of [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]-ethylcarbamic acid (CID 67321519) is [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]-ethylcarbamic acid.
What is the SMILES notation for [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]-ethylcarbamic acid?
The canonical SMILES for [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]-ethylcarbamic acid is CCN(C(=O)O)c1cccc(Cc2nn(-c3cc(F)cc(F)c3)ccc2=O)c1.
What is the InChIKey of [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]-ethylcarbamic acid?
The InChIKey is XNPYPGUEKTZTCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F2N3O3/c1-2-24(20(27)28)16-5-3-4-13(8-16)9-18-19(26)6-7-25(23-18)17-11-14(21)10-15(22)12-17/h3-8,10-12H,2,9H2,1H3,(H,27,28).
What are the key properties of [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]-ethylcarbamic acid?
[3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]-ethylcarbamic acid has a molecular weight of 385.37 g/mol, XLogP of 3.61, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[1-(3,5-difluorophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]-ethylcarbamic acid is sourced from PubChem (CID 67321519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).