C30H30F3NO5 — CID 67321701
(4S)-5,5-dimethyl-4-phenyl-3-[(2S,3S)-5,5,5-trifluoro-3-hydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]pentanoyl]-1,3-oxazolidin-2-one (PubChem CID 67321701) has the molecular formula C30H30F3NO5 and a molecular weight of 541.57 g/mol. Its IUPAC name is (4S)-5,5-dimethyl-4-phenyl-3-[(2S,3S)-5,5,5-trifluoro-3-hydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]pentanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-5,5-dimethyl-4-phenyl-3-[(2S,3S)-5,5,5-trifluoro-3-hydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]pentanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 67321701 |
| Molecular Formula | C30H30F3NO5 |
| Molecular Weight | 541.57 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | (4S)-5,5-dimethyl-4-phenyl-3-[(2S,3S)-5,5,5-trifluoro-3-hydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]pentanoyl]-1,3-oxazolidin-2-one |
| SMILES | CC1(C)OC(=O)N(C(=O)[C@@](C)(OCc2ccc(-c3ccccc3)cc2)[C@@H](O)CC(F)(F)F)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C30H30F3NO5/c1-28(2)25(23-12-8-5-9-13-23)34(27(37)39-28)26(36)29(3,24(35)18-30(31,32)33)38-19-20-14-16-22(17-15-20)21-10-6-4-7-11-21/h4-17,24-25,35H,18-19H2,1-3H3/t24-,25-,29-/m0/s1 |
| InChIKey | VZGUIJAYCGMWPP-QEMZJVQQSA-N |
| XLogP | 6.44 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.57 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |