C27H31F3N4O3S — CID 67321703
1,2,3,4-tetrahydronaphthalen-1-yl (2R)-3-methyl-2-[1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetyl]piperidin-4-yl]-2H-1,3-thiazole-4-carboxylate (PubChem CID 67321703) has the molecular formula C27H31F3N4O3S and a molecular weight of 548.63 g/mol. Its IUPAC name is 1,2,3,4-tetrahydronaphthalen-1-yl (2R)-3-methyl-2-[1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetyl]piperidin-4-yl]-2H-1,3-thiazole-4-carboxylate.
| Compound Name | 1,2,3,4-tetrahydronaphthalen-1-yl (2R)-3-methyl-2-[1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetyl]piperidin-4-yl]-2H-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 67321703 |
| Molecular Formula | C27H31F3N4O3S |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | 1,2,3,4-tetrahydronaphthalen-1-yl (2R)-3-methyl-2-[1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetyl]piperidin-4-yl]-2H-1,3-thiazole-4-carboxylate |
| SMILES | Cc1cc(C(F)(F)F)nn1CC(=O)N1CCC([C@H]2SC=C(C(=O)OC3CCCc4ccccc43)N2C)CC1 |
| InChI | InChI=1S/C27H31F3N4O3S/c1-17-14-23(27(28,29)30)31-34(17)15-24(35)33-12-10-19(11-13-33)25-32(2)21(16-38-25)26(36)37-22-9-5-7-18-6-3-4-8-20(18)22/h3-4,6,8,14,16,19,22,25H,5,7,9-13,15H2,1-2H3/t22?,25-/m1/s1 |
| InChIKey | YCDMMWJYKWHGCR-NRWPOFLRSA-N |
| XLogP | 4.92 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |