About [3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamic acid
[3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamic acid (PubChem CID 67321872) has the molecular formula C18H12F3N3O3
and a molecular weight of 375.31 g/mol. Its IUPAC name is [3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamic acid.
Molecular Properties
| Compound Name | [3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamic acid |
| PubChem CID | 67321872 |
| Molecular Formula | C18H12F3N3O3 |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | [3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamic acid |
| SMILES | O=C(O)Nc1cccc(Cc2nn(-c3cc(F)c(F)c(F)c3)ccc2=O)c1 |
| InChI | InChI=1S/C18H12F3N3O3/c19-13-8-12(9-14(20)17(13)21)24-5-4-16(25)15(23-24)7-10-2-1-3-11(6-10)22-18(26)27/h1-6,8-9,22H,7H2,(H,26,27) |
| InChIKey | DLHDZIYPIXHSHR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze [3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamic acid?
The IUPAC name of [3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamic acid (CID 67321872) is [3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamic acid.
What is the SMILES notation for [3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamic acid?
The canonical SMILES for [3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamic acid is O=C(O)Nc1cccc(Cc2nn(-c3cc(F)c(F)c(F)c3)ccc2=O)c1.
What is the InChIKey of [3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamic acid?
The InChIKey is DLHDZIYPIXHSHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F3N3O3/c19-13-8-12(9-14(20)17(13)21)24-5-4-16(25)15(23-24)7-10-2-1-3-11(6-10)22-18(26)27/h1-6,8-9,22H,7H2,(H,26,27).
What are the key properties of [3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamic acid?
[3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamic acid has a molecular weight of 375.31 g/mol, XLogP of 3.33, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[4-oxo-1-(3,4,5-trifluorophenyl)pyridazin-3-yl]methyl]phenyl]carbamic acid is sourced from PubChem (CID 67321872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).