About 6-chlorocyclohexa-2,4-dien-1-one
6-chlorocyclohexa-2,4-dien-1-one (PubChem CID 67322600) has the molecular formula C6H5ClO
and a molecular weight of 128.56 g/mol. Its IUPAC name is 6-chlorocyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 6-chlorocyclohexa-2,4-dien-1-one |
| PubChem CID | 67322600 |
| Molecular Formula | C6H5ClO |
| Molecular Weight | 128.56 g/mol |
| Exact Mass | 128.00 |
| IUPAC Name | 6-chlorocyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC=CC1Cl |
| InChI | InChI=1S/C6H5ClO/c7-5-3-1-2-4-6(5)8/h1-5H |
| InChIKey | GEAWPTXAKMRHRY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.56 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-chlorocyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chlorocyclohexa-2,4-dien-1-one?
The IUPAC name of 6-chlorocyclohexa-2,4-dien-1-one (CID 67322600) is 6-chlorocyclohexa-2,4-dien-1-one.
What is the SMILES notation for 6-chlorocyclohexa-2,4-dien-1-one?
The canonical SMILES for 6-chlorocyclohexa-2,4-dien-1-one is O=C1C=CC=CC1Cl.
What is the InChIKey of 6-chlorocyclohexa-2,4-dien-1-one?
The InChIKey is GEAWPTXAKMRHRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClO/c7-5-3-1-2-4-6(5)8/h1-5H.
What are the key properties of 6-chlorocyclohexa-2,4-dien-1-one?
6-chlorocyclohexa-2,4-dien-1-one has a molecular weight of 128.56 g/mol, XLogP of 1.29, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chlorocyclohexa-2,4-dien-1-one is sourced from PubChem (CID 67322600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).