C25H38N4O — CID 67322961
4-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)triazol-1-yl]piperidin-1-yl]butan-1-ol (PubChem CID 67322961) has the molecular formula C25H38N4O and a molecular weight of 410.61 g/mol. Its IUPAC name is 4-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)triazol-1-yl]piperidin-1-yl]butan-1-ol.
| Compound Name | 4-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)triazol-1-yl]piperidin-1-yl]butan-1-ol |
|---|---|
| PubChem CID | 67322961 |
| Molecular Formula | C25H38N4O |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | 4-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)triazol-1-yl]piperidin-1-yl]butan-1-ol |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cn(C4CCN(CCCCO)CC4)nn3)ccc21 |
| InChI | InChI=1S/C25H38N4O/c1-24(2)11-12-25(3,4)22-17-19(7-8-21(22)24)23-18-29(27-26-23)20-9-14-28(15-10-20)13-5-6-16-30/h7-8,17-18,20,30H,5-6,9-16H2,1-4H3 |
| InChIKey | NLQPGBHNIIBYIH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|