C23H25FN6O3S — CID 67323327
2-[10-(benzenesulfonyl)-12-[(3S,4R)-4-ethyl-3-fluoropiperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl]acetamide (PubChem CID 67323327) has the molecular formula C23H25FN6O3S and a molecular weight of 484.56 g/mol. Its IUPAC name is 2-[10-(benzenesulfonyl)-12-[(3S,4R)-4-ethyl-3-fluoropiperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl]acetamide.
| Compound Name | 2-[10-(benzenesulfonyl)-12-[(3S,4R)-4-ethyl-3-fluoropiperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl]acetamide |
|---|---|
| PubChem CID | 67323327 |
| Molecular Formula | C23H25FN6O3S |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 2-[10-(benzenesulfonyl)-12-[(3S,4R)-4-ethyl-3-fluoropiperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl]acetamide |
| SMILES | CC[C@]1(c2cn(S(=O)(=O)c3ccccc3)c3ncc4[nH]c(CC(N)=O)nc4c23)CCNC[C@H]1F |
| InChI | InChI=1S/C23H25FN6O3S/c1-2-23(8-9-26-12-17(23)24)15-13-30(34(32,33)14-6-4-3-5-7-14)22-20(15)21-16(11-27-22)28-19(29-21)10-18(25)31/h3-7,11,13,17,26H,2,8-10,12H2,1H3,(H2,25,31)(H,28,29)/t17-,23-/m1/s1 |
| InChIKey | RXGVQLZPTBLBEX-UZUQRXQVSA-N |
| XLogP | 2.16 |
| TPSA | 135.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |