About (4-methoxy-4-nitrocyclohexa-1,5-dien-1-yl)methanol
(4-methoxy-4-nitrocyclohexa-1,5-dien-1-yl)methanol (PubChem CID 67323487) has the molecular formula C8H11NO4
and a molecular weight of 185.18 g/mol. Its IUPAC name is (4-methoxy-4-nitrocyclohexa-1,5-dien-1-yl)methanol.
Molecular Properties
| Compound Name | (4-methoxy-4-nitrocyclohexa-1,5-dien-1-yl)methanol |
| PubChem CID | 67323487 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | (4-methoxy-4-nitrocyclohexa-1,5-dien-1-yl)methanol |
| SMILES | COC1([N+](=O)[O-])C=CC(CO)=CC1 |
| InChI | InChI=1S/C8H11NO4/c1-13-8(9(11)12)4-2-7(6-10)3-5-8/h2-4,10H,5-6H2,1H3 |
| InChIKey | RDMFGOGXXXUKNG-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxy-4-nitrocyclohexa-1,5-dien-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxy-4-nitrocyclohexa-1,5-dien-1-yl)methanol?
The IUPAC name of (4-methoxy-4-nitrocyclohexa-1,5-dien-1-yl)methanol (CID 67323487) is (4-methoxy-4-nitrocyclohexa-1,5-dien-1-yl)methanol.
What is the SMILES notation for (4-methoxy-4-nitrocyclohexa-1,5-dien-1-yl)methanol?
The canonical SMILES for (4-methoxy-4-nitrocyclohexa-1,5-dien-1-yl)methanol is COC1([N+](=O)[O-])C=CC(CO)=CC1.
What is the InChIKey of (4-methoxy-4-nitrocyclohexa-1,5-dien-1-yl)methanol?
The InChIKey is RDMFGOGXXXUKNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO4/c1-13-8(9(11)12)4-2-7(6-10)3-5-8/h2-4,10H,5-6H2,1H3.
What are the key properties of (4-methoxy-4-nitrocyclohexa-1,5-dien-1-yl)methanol?
(4-methoxy-4-nitrocyclohexa-1,5-dien-1-yl)methanol has a molecular weight of 185.18 g/mol, XLogP of 0.48, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxy-4-nitrocyclohexa-1,5-dien-1-yl)methanol is sourced from PubChem (CID 67323487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).