C15H14F3N3O6 — CID 67323574
(6S,7S)-7-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-ol (PubChem CID 67323574) has the molecular formula C15H14F3N3O6 and a molecular weight of 389.29 g/mol. Its IUPAC name is (6S,7S)-7-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-ol.
| Compound Name | (6S,7S)-7-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-ol |
|---|---|
| PubChem CID | 67323574 |
| Molecular Formula | C15H14F3N3O6 |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | (6S,7S)-7-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-ol |
| SMILES | O=[N+]([O-])c1cn2c(n1)O[C@@H](CC(O)c1ccc(OC(F)(F)F)cc1)[C@@H](O)C2 |
| InChI | InChI=1S/C15H14F3N3O6/c16-15(17,18)27-9-3-1-8(2-4-9)10(22)5-12-11(23)6-20-7-13(21(24)25)19-14(20)26-12/h1-4,7,10-12,22-23H,5-6H2/t10?,11-,12-/m0/s1 |
| InChIKey | LDGKISVKJCBQDE-RAMGSTBQSA-N |
| XLogP | 1.94 |
| TPSA | 119.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|