C28H27N5O4S — CID 67323850
benzyl 3-[10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]-3-methylpiperidine-1-carboxylate (PubChem CID 67323850) has the molecular formula C28H27N5O4S and a molecular weight of 529.62 g/mol. Its IUPAC name is benzyl 3-[10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]-3-methylpiperidine-1-carboxylate.
| Compound Name | benzyl 3-[10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 67323850 |
| Molecular Formula | C28H27N5O4S |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | benzyl 3-[10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]-3-methylpiperidine-1-carboxylate |
| SMILES | CC1(n2cnc3cnc4c(ccn4S(=O)(=O)c4ccccc4)c32)CCCN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C28H27N5O4S/c1-28(14-8-15-31(19-28)27(34)37-18-21-9-4-2-5-10-21)32-20-30-24-17-29-26-23(25(24)32)13-16-33(26)38(35,36)22-11-6-3-7-12-22/h2-7,9-13,16-17,20H,8,14-15,18-19H2,1H3 |
| InChIKey | BFVNEWGPLGJKSC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 99.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |