About 5-(2-fluorophenoxy)-[1,3]oxazolo[5,4-d]pyrimidine
5-(2-fluorophenoxy)-[1,3]oxazolo[5,4-d]pyrimidine (PubChem CID 67324022) has the molecular formula C11H6FN3O2
and a molecular weight of 231.19 g/mol. Its IUPAC name is 5-(2-fluorophenoxy)-[1,3]oxazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 5-(2-fluorophenoxy)-[1,3]oxazolo[5,4-d]pyrimidine |
| PubChem CID | 67324022 |
| Molecular Formula | C11H6FN3O2 |
| Molecular Weight | 231.19 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 5-(2-fluorophenoxy)-[1,3]oxazolo[5,4-d]pyrimidine |
| SMILES | Fc1ccccc1Oc1ncc2ncoc2n1 |
| InChI | InChI=1S/C11H6FN3O2/c12-7-3-1-2-4-9(7)17-11-13-5-8-10(15-11)16-6-14-8/h1-6H |
| InChIKey | GBDDYSPXVQKQFJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.19 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2-fluorophenoxy)-[1,3]oxazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-fluorophenoxy)-[1,3]oxazolo[5,4-d]pyrimidine?
The IUPAC name of 5-(2-fluorophenoxy)-[1,3]oxazolo[5,4-d]pyrimidine (CID 67324022) is 5-(2-fluorophenoxy)-[1,3]oxazolo[5,4-d]pyrimidine.
What is the SMILES notation for 5-(2-fluorophenoxy)-[1,3]oxazolo[5,4-d]pyrimidine?
The canonical SMILES for 5-(2-fluorophenoxy)-[1,3]oxazolo[5,4-d]pyrimidine is Fc1ccccc1Oc1ncc2ncoc2n1.
What is the InChIKey of 5-(2-fluorophenoxy)-[1,3]oxazolo[5,4-d]pyrimidine?
The InChIKey is GBDDYSPXVQKQFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6FN3O2/c12-7-3-1-2-4-9(7)17-11-13-5-8-10(15-11)16-6-14-8/h1-6H.
What are the key properties of 5-(2-fluorophenoxy)-[1,3]oxazolo[5,4-d]pyrimidine?
5-(2-fluorophenoxy)-[1,3]oxazolo[5,4-d]pyrimidine has a molecular weight of 231.19 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-fluorophenoxy)-[1,3]oxazolo[5,4-d]pyrimidine is sourced from PubChem (CID 67324022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).