About propan-2-yl 2-[(3S)-3-[(4,5-dimethylthiophen-2-yl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxylate
propan-2-yl 2-[(3S)-3-[(4,5-dimethylthiophen-2-yl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxylate (PubChem CID 67324050) has the molecular formula C20H27N3O2S
and a molecular weight of 373.52 g/mol. Its IUPAC name is propan-2-yl 2-[(3S)-3-[(4,5-dimethylthiophen-2-yl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 2-[(3S)-3-[(4,5-dimethylthiophen-2-yl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxylate |
| PubChem CID | 67324050 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | propan-2-yl 2-[(3S)-3-[(4,5-dimethylthiophen-2-yl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxylate |
| SMILES | Cc1cc(CN[C@H]2CCN(c3ncccc3C(=O)OC(C)C)C2)sc1C |
| InChI | InChI=1S/C20H27N3O2S/c1-13(2)25-20(24)18-6-5-8-21-19(18)23-9-7-16(12-23)22-11-17-10-14(3)15(4)26-17/h5-6,8,10,13,16,22H,7,9,11-12H2,1-4H3/t16-/m0/s1 |
| InChIKey | WODCOPPHOWFQCM-INIZCTEOSA-N |
| XLogP | 3.69 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze propan-2-yl 2-[(3S)-3-[(4,5-dimethylthiophen-2-yl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-[(3S)-3-[(4,5-dimethylthiophen-2-yl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxylate?
The IUPAC name of propan-2-yl 2-[(3S)-3-[(4,5-dimethylthiophen-2-yl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxylate (CID 67324050) is propan-2-yl 2-[(3S)-3-[(4,5-dimethylthiophen-2-yl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxylate.
What is the SMILES notation for propan-2-yl 2-[(3S)-3-[(4,5-dimethylthiophen-2-yl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxylate?
The canonical SMILES for propan-2-yl 2-[(3S)-3-[(4,5-dimethylthiophen-2-yl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxylate is Cc1cc(CN[C@H]2CCN(c3ncccc3C(=O)OC(C)C)C2)sc1C.
What is the InChIKey of propan-2-yl 2-[(3S)-3-[(4,5-dimethylthiophen-2-yl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxylate?
The InChIKey is WODCOPPHOWFQCM-INIZCTEOSA-N. The full InChI is InChI=1S/C20H27N3O2S/c1-13(2)25-20(24)18-6-5-8-21-19(18)23-9-7-16(12-23)22-11-17-10-14(3)15(4)26-17/h5-6,8,10,13,16,22H,7,9,11-12H2,1-4H3/t16-/m0/s1.
What are the key properties of propan-2-yl 2-[(3S)-3-[(4,5-dimethylthiophen-2-yl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxylate?
propan-2-yl 2-[(3S)-3-[(4,5-dimethylthiophen-2-yl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxylate has a molecular weight of 373.52 g/mol, XLogP of 3.69, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-[(3S)-3-[(4,5-dimethylthiophen-2-yl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxylate is sourced from PubChem (CID 67324050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).