C20H26N4O2 — CID 67324124
propan-2-yl 2-[4-[(4-aminophenyl)methyl]piperazin-1-yl]pyridine-3-carboxylate (PubChem CID 67324124) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is propan-2-yl 2-[4-[(4-aminophenyl)methyl]piperazin-1-yl]pyridine-3-carboxylate.
| Compound Name | propan-2-yl 2-[4-[(4-aminophenyl)methyl]piperazin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 67324124 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | propan-2-yl 2-[4-[(4-aminophenyl)methyl]piperazin-1-yl]pyridine-3-carboxylate |
| SMILES | CC(C)OC(=O)c1cccnc1N1CCN(Cc2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C20H26N4O2/c1-15(2)26-20(25)18-4-3-9-22-19(18)24-12-10-23(11-13-24)14-16-5-7-17(21)8-6-16/h3-9,15H,10-14,21H2,1-2H3 |
| InChIKey | QCNUTVDMWXVCJE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|