C22H23F3N6O2S — CID 67324251
[10-(benzenesulfonyl)-12-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl]methanamine (PubChem CID 67324251) has the molecular formula C22H23F3N6O2S and a molecular weight of 492.53 g/mol. Its IUPAC name is [10-(benzenesulfonyl)-12-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl]methanamine.
| Compound Name | [10-(benzenesulfonyl)-12-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl]methanamine |
|---|---|
| PubChem CID | 67324251 |
| Molecular Formula | C22H23F3N6O2S |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | [10-(benzenesulfonyl)-12-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl]methanamine |
| SMILES | NCc1nc2c(cnc3c2c(C2CCN(CC(F)(F)F)CC2)cn3S(=O)(=O)c2ccccc2)[nH]1 |
| InChI | InChI=1S/C22H23F3N6O2S/c23-22(24,25)13-30-8-6-14(7-9-30)16-12-31(34(32,33)15-4-2-1-3-5-15)21-19(16)20-17(11-27-21)28-18(10-26)29-20/h1-5,11-12,14H,6-10,13,26H2,(H,28,29) |
| InChIKey | QRMZBNGPVQJXMQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |