C13H19F2NO — CID 67324301
1,2,3,4,4a,4b,5,9a-octahydro-[1]benzofuro[2,3-c]pyridine;1,1-difluoroethane (PubChem CID 67324301) has the molecular formula C13H19F2NO and a molecular weight of 243.30 g/mol. Its IUPAC name is 1,2,3,4,4a,4b,5,9a-octahydro-[1]benzofuro[2,3-c]pyridine;1,1-difluoroethane.
| Compound Name | 1,2,3,4,4a,4b,5,9a-octahydro-[1]benzofuro[2,3-c]pyridine;1,1-difluoroethane |
|---|---|
| PubChem CID | 67324301 |
| Molecular Formula | C13H19F2NO |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 1,2,3,4,4a,4b,5,9a-octahydro-[1]benzofuro[2,3-c]pyridine;1,1-difluoroethane |
| SMILES | C1=CCC2C(=C1)OC1CNCCC12.CC(F)F |
| InChI | InChI=1S/C11H15NO.C2H4F2/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10;1-2(3)4/h1-2,4,8-9,11-12H,3,5-7H2;2H,1H3 |
| InChIKey | IAPQEAIDLRYIDJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |