C27H40N2OS — CID 67324527
5-[3-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]pentan-1-ol (PubChem CID 67324527) has the molecular formula C27H40N2OS and a molecular weight of 440.70 g/mol. Its IUPAC name is 5-[3-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]pentan-1-ol.
| Compound Name | 5-[3-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]pentan-1-ol |
|---|---|
| PubChem CID | 67324527 |
| Molecular Formula | C27H40N2OS |
| Molecular Weight | 440.70 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | 5-[3-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]pentan-1-ol |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3csc(C4CCCN(CCCCCO)C4)n3)ccc21 |
| InChI | InChI=1S/C27H40N2OS/c1-26(2)12-13-27(3,4)23-17-20(10-11-22(23)26)24-19-31-25(28-24)21-9-8-15-29(18-21)14-6-5-7-16-30/h10-11,17,19,21,30H,5-9,12-16,18H2,1-4H3 |
| InChIKey | CNKWJDKOKBCVPY-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.70 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|