C25H37N3OS — CID 67324547
(2R)-2-amino-3-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]propan-1-ol (PubChem CID 67324547) has the molecular formula C25H37N3OS and a molecular weight of 427.66 g/mol. Its IUPAC name is (2R)-2-amino-3-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]propan-1-ol.
| Compound Name | (2R)-2-amino-3-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 67324547 |
| Molecular Formula | C25H37N3OS |
| Molecular Weight | 427.66 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | (2R)-2-amino-3-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]propan-1-ol |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3csc(C4CCN(C[C@@H](N)CO)CC4)n3)ccc21 |
| InChI | InChI=1S/C25H37N3OS/c1-24(2)9-10-25(3,4)21-13-18(5-6-20(21)24)22-16-30-23(27-22)17-7-11-28(12-8-17)14-19(26)15-29/h5-6,13,16-17,19,29H,7-12,14-15,26H2,1-4H3/t19-/m1/s1 |
| InChIKey | DBQARPGEEZGRMB-LJQANCHMSA-N |
| XLogP | 4.66 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.66 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |