C27H33N5O6S2 — CID 67325138
tert-butyl N-[[10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl]-cyclohexylmethyl]-N-methylsulfonylcarbamate (PubChem CID 67325138) has the molecular formula C27H33N5O6S2 and a molecular weight of 587.72 g/mol. Its IUPAC name is tert-butyl N-[[10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl]-cyclohexylmethyl]-N-methylsulfonylcarbamate.
| Compound Name | tert-butyl N-[[10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl]-cyclohexylmethyl]-N-methylsulfonylcarbamate |
|---|---|
| PubChem CID | 67325138 |
| Molecular Formula | C27H33N5O6S2 |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | tert-butyl N-[[10-(benzenesulfonyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl]-cyclohexylmethyl]-N-methylsulfonylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(C(c1nc2c(cnc3c2ccn3S(=O)(=O)c2ccccc2)[nH]1)C1CCCCC1)S(C)(=O)=O |
| InChI | InChI=1S/C27H33N5O6S2/c1-27(2,3)38-26(33)32(39(4,34)35)23(18-11-7-5-8-12-18)24-29-21-17-28-25-20(22(21)30-24)15-16-31(25)40(36,37)19-13-9-6-10-14-19/h6,9-10,13-18,23H,5,7-8,11-12H2,1-4H3,(H,29,30) |
| InChIKey | ROAVGRYOZZPXNG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |