About 2-(1-hydroxy-2-methylpropyl)-1,2-dihydropyrrol-5-one
2-(1-hydroxy-2-methylpropyl)-1,2-dihydropyrrol-5-one (PubChem CID 67325317) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is 2-(1-hydroxy-2-methylpropyl)-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 2-(1-hydroxy-2-methylpropyl)-1,2-dihydropyrrol-5-one |
| PubChem CID | 67325317 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 2-(1-hydroxy-2-methylpropyl)-1,2-dihydropyrrol-5-one |
| SMILES | CC(C)C(O)C1C=CC(=O)N1 |
| InChI | InChI=1S/C8H13NO2/c1-5(2)8(11)6-3-4-7(10)9-6/h3-6,8,11H,1-2H3,(H,9,10) |
| InChIKey | KEXLDCZOOSFIOH-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1-hydroxy-2-methylpropyl)-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hydroxy-2-methylpropyl)-1,2-dihydropyrrol-5-one?
The IUPAC name of 2-(1-hydroxy-2-methylpropyl)-1,2-dihydropyrrol-5-one (CID 67325317) is 2-(1-hydroxy-2-methylpropyl)-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 2-(1-hydroxy-2-methylpropyl)-1,2-dihydropyrrol-5-one?
The canonical SMILES for 2-(1-hydroxy-2-methylpropyl)-1,2-dihydropyrrol-5-one is CC(C)C(O)C1C=CC(=O)N1.
What is the InChIKey of 2-(1-hydroxy-2-methylpropyl)-1,2-dihydropyrrol-5-one?
The InChIKey is KEXLDCZOOSFIOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2/c1-5(2)8(11)6-3-4-7(10)9-6/h3-6,8,11H,1-2H3,(H,9,10).
What are the key properties of 2-(1-hydroxy-2-methylpropyl)-1,2-dihydropyrrol-5-one?
2-(1-hydroxy-2-methylpropyl)-1,2-dihydropyrrol-5-one has a molecular weight of 155.20 g/mol, XLogP of 0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxy-2-methylpropyl)-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 67325317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).