About 1,3-thiazol-5-ylmethyl 4-(2-quinolin-6-yloxyethyl)piperidine-1-carboxylate
1,3-thiazol-5-ylmethyl 4-(2-quinolin-6-yloxyethyl)piperidine-1-carboxylate (PubChem CID 67325507) has the molecular formula C21H23N3O3S
and a molecular weight of 397.50 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl 4-(2-quinolin-6-yloxyethyl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | 1,3-thiazol-5-ylmethyl 4-(2-quinolin-6-yloxyethyl)piperidine-1-carboxylate |
| PubChem CID | 67325507 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl 4-(2-quinolin-6-yloxyethyl)piperidine-1-carboxylate |
| SMILES | O=C(OCc1cncs1)N1CCC(CCOc2ccc3ncccc3c2)CC1 |
| InChI | InChI=1S/C21H23N3O3S/c25-21(27-14-19-13-22-15-28-19)24-9-5-16(6-10-24)7-11-26-18-3-4-20-17(12-18)2-1-8-23-20/h1-4,8,12-13,15-16H,5-7,9-11,14H2 |
| InChIKey | FSPMWVLIKXSJAK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,3-thiazol-5-ylmethyl 4-(2-quinolin-6-yloxyethyl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-thiazol-5-ylmethyl 4-(2-quinolin-6-yloxyethyl)piperidine-1-carboxylate?
The IUPAC name of 1,3-thiazol-5-ylmethyl 4-(2-quinolin-6-yloxyethyl)piperidine-1-carboxylate (CID 67325507) is 1,3-thiazol-5-ylmethyl 4-(2-quinolin-6-yloxyethyl)piperidine-1-carboxylate.
What is the SMILES notation for 1,3-thiazol-5-ylmethyl 4-(2-quinolin-6-yloxyethyl)piperidine-1-carboxylate?
The canonical SMILES for 1,3-thiazol-5-ylmethyl 4-(2-quinolin-6-yloxyethyl)piperidine-1-carboxylate is O=C(OCc1cncs1)N1CCC(CCOc2ccc3ncccc3c2)CC1.
What is the InChIKey of 1,3-thiazol-5-ylmethyl 4-(2-quinolin-6-yloxyethyl)piperidine-1-carboxylate?
The InChIKey is FSPMWVLIKXSJAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O3S/c25-21(27-14-19-13-22-15-28-19)24-9-5-16(6-10-24)7-11-26-18-3-4-20-17(12-18)2-1-8-23-20/h1-4,8,12-13,15-16H,5-7,9-11,14H2.
What are the key properties of 1,3-thiazol-5-ylmethyl 4-(2-quinolin-6-yloxyethyl)piperidine-1-carboxylate?
1,3-thiazol-5-ylmethyl 4-(2-quinolin-6-yloxyethyl)piperidine-1-carboxylate has a molecular weight of 397.50 g/mol, XLogP of 4.51, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-thiazol-5-ylmethyl 4-(2-quinolin-6-yloxyethyl)piperidine-1-carboxylate is sourced from PubChem (CID 67325507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).