C17H15Cl2NOS — CID 67325834
2,3-dichlorobenzenethiol;1,2,3,4-tetrahydro-[1]benzofuro[2,3-c]pyridine (PubChem CID 67325834) has the molecular formula C17H15Cl2NOS and a molecular weight of 352.29 g/mol. Its IUPAC name is 2,3-dichlorobenzenethiol;1,2,3,4-tetrahydro-[1]benzofuro[2,3-c]pyridine.
| Compound Name | 2,3-dichlorobenzenethiol;1,2,3,4-tetrahydro-[1]benzofuro[2,3-c]pyridine |
|---|---|
| PubChem CID | 67325834 |
| Molecular Formula | C17H15Cl2NOS |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 2,3-dichlorobenzenethiol;1,2,3,4-tetrahydro-[1]benzofuro[2,3-c]pyridine |
| SMILES | Sc1cccc(Cl)c1Cl.c1ccc2c3c(oc2c1)CNCC3 |
| InChI | InChI=1S/C11H11NO.C6H4Cl2S/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10;7-4-2-1-3-5(9)6(4)8/h1-4,12H,5-7H2;1-3,9H |
| InChIKey | WTOPKRWJZYLGKX-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|