C13H20N2O2 — CID 67325875
[1-(4-aminophenyl)-2,2-dimethylpropyl]-methylcarbamic acid (PubChem CID 67325875) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is [1-(4-aminophenyl)-2,2-dimethylpropyl]-methylcarbamic acid.
| Compound Name | [1-(4-aminophenyl)-2,2-dimethylpropyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 67325875 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | [1-(4-aminophenyl)-2,2-dimethylpropyl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)C(c1ccc(N)cc1)C(C)(C)C |
| InChI | InChI=1S/C13H20N2O2/c1-13(2,3)11(15(4)12(16)17)9-5-7-10(14)8-6-9/h5-8,11H,14H2,1-4H3,(H,16,17) |
| InChIKey | JXGNMBZTTXANMC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|