C31H38N4O9 — CID 67326035
ethyl 2-[[3-[[3-cyclohexyl-2-[(3-nitrobenzoyl)amino]propanoyl]amino]-2-oxo-4-phenylmethoxybutanoyl]amino]acetate (PubChem CID 67326035) has the molecular formula C31H38N4O9 and a molecular weight of 610.66 g/mol. Its IUPAC name is ethyl 2-[[3-[[3-cyclohexyl-2-[(3-nitrobenzoyl)amino]propanoyl]amino]-2-oxo-4-phenylmethoxybutanoyl]amino]acetate.
| Compound Name | ethyl 2-[[3-[[3-cyclohexyl-2-[(3-nitrobenzoyl)amino]propanoyl]amino]-2-oxo-4-phenylmethoxybutanoyl]amino]acetate |
|---|---|
| PubChem CID | 67326035 |
| Molecular Formula | C31H38N4O9 |
| Molecular Weight | 610.66 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | ethyl 2-[[3-[[3-cyclohexyl-2-[(3-nitrobenzoyl)amino]propanoyl]amino]-2-oxo-4-phenylmethoxybutanoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)C(=O)C(COCc1ccccc1)NC(=O)C(CC1CCCCC1)NC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H38N4O9/c1-2-44-27(36)18-32-31(40)28(37)26(20-43-19-22-12-7-4-8-13-22)34-30(39)25(16-21-10-5-3-6-11-21)33-29(38)23-14-9-15-24(17-23)35(41)42/h4,7-9,12-15,17,21,25-26H,2-3,5-6,10-11,16,18-20H2,1H3,(H,32,40)(H,33,38)(H,34,39) |
| InChIKey | XBUBPRKAPGUVJJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 183.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.66 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|